C28H40N4O4S — CID 5287858
N-[(2S)-1-[[(3S)-1-(hydroxy-oxo-phenyl-λ6-sulfanylidene)-5-phenylpentan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]piperazine-1-carboxamide (PubChem CID 5287858) has the molecular formula C28H40N4O4S and a molecular weight of 528.72 g/mol. Its IUPAC name is N-[(2S)-1-[[(3S)-1-(hydroxy-oxo-phenyl-λ6-sulfanylidene)-5-phenylpentan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]piperazine-1-carboxamide.
| Compound Name | N-[(2S)-1-[[(3S)-1-(hydroxy-oxo-phenyl-λ6-sulfanylidene)-5-phenylpentan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 5287858 |
| Molecular Formula | C28H40N4O4S |
| Molecular Weight | 528.72 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | N-[(2S)-1-[[(3S)-1-(hydroxy-oxo-phenyl-λ6-sulfanylidene)-5-phenylpentan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]piperazine-1-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)N1CCNCC1)C(=O)N[C@H](CC=S(=O)(O)c1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C28H40N4O4S/c1-22(2)21-26(31-28(34)32-18-16-29-17-19-32)27(33)30-24(14-13-23-9-5-3-6-10-23)15-20-37(35,36)25-11-7-4-8-12-25/h3-12,20,22,24,26,29H,13-19,21H2,1-2H3,(H,30,33)(H,31,34)(H,35,36)/t24-,26-/m0/s1 |
| InChIKey | RFZFBTDYVCTWPF-AHWVRZQESA-N |
| XLogP | 3.14 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.72 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|