C17H24ClN3O3S2 — CID 52880185
3-[6-chloro-3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanyl-N,N-dimethylpropane-1-sulfonamide (PubChem CID 52880185) has the molecular formula C17H24ClN3O3S2 and a molecular weight of 417.98 g/mol. Its IUPAC name is 3-[6-chloro-3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanyl-N,N-dimethylpropane-1-sulfonamide.
| Compound Name | 3-[6-chloro-3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanyl-N,N-dimethylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 52880185 |
| Molecular Formula | C17H24ClN3O3S2 |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 3-[6-chloro-3-(2-methylpropyl)-4-oxoquinazolin-2-yl]sulfanyl-N,N-dimethylpropane-1-sulfonamide |
| SMILES | CC(C)Cn1c(SCCCS(=O)(=O)N(C)C)nc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C17H24ClN3O3S2/c1-12(2)11-21-16(22)14-10-13(18)6-7-15(14)19-17(21)25-8-5-9-26(23,24)20(3)4/h6-7,10,12H,5,8-9,11H2,1-4H3 |
| InChIKey | NCSPFQANEIOZKA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|