C20H21ClN2OS — CID 7355891
6-chloro-2-[(4-methylphenyl)methylsulfanyl]-3-(2-methylpropyl)quinazolin-4-one (PubChem CID 7355891) has the molecular formula C20H21ClN2OS and a molecular weight of 372.92 g/mol. Its IUPAC name is 6-chloro-2-[(4-methylphenyl)methylsulfanyl]-3-(2-methylpropyl)quinazolin-4-one.
| Compound Name | 6-chloro-2-[(4-methylphenyl)methylsulfanyl]-3-(2-methylpropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 7355891 |
| Molecular Formula | C20H21ClN2OS |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 6-chloro-2-[(4-methylphenyl)methylsulfanyl]-3-(2-methylpropyl)quinazolin-4-one |
| SMILES | Cc1ccc(CSc2nc3ccc(Cl)cc3c(=O)n2CC(C)C)cc1 |
| InChI | InChI=1S/C20H21ClN2OS/c1-13(2)11-23-19(24)17-10-16(21)8-9-18(17)22-20(23)25-12-15-6-4-14(3)5-7-15/h4-10,13H,11-12H2,1-3H3 |
| InChIKey | PLFCJBATPAMCGS-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |