C13H26N2O2 — CID 5289290
(2R)-2-tert-butyl-N'-pentan-3-ylbutanediamide (PubChem CID 5289290) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is (2R)-2-tert-butyl-N'-pentan-3-ylbutanediamide.
| Compound Name | (2R)-2-tert-butyl-N'-pentan-3-ylbutanediamide |
|---|---|
| PubChem CID | 5289290 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | (2R)-2-tert-butyl-N'-pentan-3-ylbutanediamide |
| SMILES | CCC(CC)NC(=O)CC(C(N)=O)C(C)(C)C |
| InChI | InChI=1S/C13H26N2O2/c1-6-9(7-2)15-11(16)8-10(12(14)17)13(3,4)5/h9-10H,6-8H2,1-5H3,(H2,14,17)(H,15,16) |
| InChIKey | UVHRROJQACYJNP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |