About (2R)-2-tert-butyl-N'-pentan-3-ylbutanediamide
(2R)-2-tert-butyl-N'-pentan-3-ylbutanediamide (PubChem CID 5289290) has the molecular formula C13H26N2O2
and a molecular weight of 242.36 g/mol. Its IUPAC name is (2R)-2-tert-butyl-N'-pentan-3-ylbutanediamide.
Molecular Properties
| Compound Name | (2R)-2-tert-butyl-N'-pentan-3-ylbutanediamide |
| PubChem CID | 5289290 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | (2R)-2-tert-butyl-N'-pentan-3-ylbutanediamide |
| SMILES | CCC(CC)NC(=O)CC(C(N)=O)C(C)(C)C |
| InChI | InChI=1S/C13H26N2O2/c1-6-9(7-2)15-11(16)8-10(12(14)17)13(3,4)5/h9-10H,6-8H2,1-5H3,(H2,14,17)(H,15,16) |
| InChIKey | UVHRROJQACYJNP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-tert-butyl-N'-pentan-3-ylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-tert-butyl-N'-pentan-3-ylbutanediamide?
The IUPAC name of (2R)-2-tert-butyl-N'-pentan-3-ylbutanediamide (CID 5289290) is (2R)-2-tert-butyl-N'-pentan-3-ylbutanediamide.
What is the SMILES notation for (2R)-2-tert-butyl-N'-pentan-3-ylbutanediamide?
The canonical SMILES for (2R)-2-tert-butyl-N'-pentan-3-ylbutanediamide is CCC(CC)NC(=O)CC(C(N)=O)C(C)(C)C.
What is the InChIKey of (2R)-2-tert-butyl-N'-pentan-3-ylbutanediamide?
The InChIKey is UVHRROJQACYJNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O2/c1-6-9(7-2)15-11(16)8-10(12(14)17)13(3,4)5/h9-10H,6-8H2,1-5H3,(H2,14,17)(H,15,16).
What are the key properties of (2R)-2-tert-butyl-N'-pentan-3-ylbutanediamide?
(2R)-2-tert-butyl-N'-pentan-3-ylbutanediamide has a molecular weight of 242.36 g/mol, XLogP of 1.83, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-tert-butyl-N'-pentan-3-ylbutanediamide is sourced from PubChem (CID 5289290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).