C30H40 — CID 5289537
(3E,5Z,8E,14Z)-5-[(E)-but-2-enyl]-3,6-dimethyl-9,11,12-trimethylidene-8-(2-methylprop-2-enylidene)heptadeca-3,5,14-trien-1-yne (PubChem CID 5289537) has the molecular formula C30H40 and a molecular weight of 400.65 g/mol. Its IUPAC name is (3E,5Z,8E,14Z)-5-[(E)-but-2-enyl]-3,6-dimethyl-9,11,12-trimethylidene-8-(2-methylprop-2-enylidene)heptadeca-3,5,14-trien-1-yne.
| Compound Name | (3E,5Z,8E,14Z)-5-[(E)-but-2-enyl]-3,6-dimethyl-9,11,12-trimethylidene-8-(2-methylprop-2-enylidene)heptadeca-3,5,14-trien-1-yne |
|---|---|
| PubChem CID | 5289537 |
| Molecular Formula | C30H40 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.31 |
| IUPAC Name | (3E,5Z,8E,14Z)-5-[(E)-but-2-enyl]-3,6-dimethyl-9,11,12-trimethylidene-8-(2-methylprop-2-enylidene)heptadeca-3,5,14-trien-1-yne |
| SMILES | C#C/C(C)=C/C(C/C=C/C)=C(/C)C/C(=C\C(=C)C)C(=C)CC(=C)C(=C)C/C=C\CC |
| InChI | InChI=1S/C30H40/c1-11-14-16-17-25(7)26(8)21-27(9)30(19-23(4)5)22-28(10)29(18-15-12-2)20-24(6)13-3/h3,12,14-16,19-20H,4,7-9,11,17-18,21-22H2,1-2,5-6,10H3/b15-12+,16-14-,24-20+,29-28-,30-19+ |
| InChIKey | RRGJQYSTOQTZTC-OONMJJEZSA-N |
| XLogP | 9.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|