C19H26N2O2S — CID 52904798
4-[(1R)-2-amino-1-(4-propan-2-ylphenyl)sulfonylethyl]-N,N-dimethylaniline (PubChem CID 52904798) has the molecular formula C19H26N2O2S and a molecular weight of 346.50 g/mol. Its IUPAC name is 4-[(1R)-2-amino-1-(4-propan-2-ylphenyl)sulfonylethyl]-N,N-dimethylaniline.
| Compound Name | 4-[(1R)-2-amino-1-(4-propan-2-ylphenyl)sulfonylethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 52904798 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 4-[(1R)-2-amino-1-(4-propan-2-ylphenyl)sulfonylethyl]-N,N-dimethylaniline |
| SMILES | CC(C)c1ccc(S(=O)(=O)[C@@H](CN)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H26N2O2S/c1-14(2)15-7-11-18(12-8-15)24(22,23)19(13-20)16-5-9-17(10-6-16)21(3)4/h5-12,14,19H,13,20H2,1-4H3/t19-/m0/s1 |
| InChIKey | QJGSMZSQYUGKTF-IBGZPJMESA-N |
| XLogP | 3.35 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|