C30H44N2O8 — CID 52916329
tert-butyl (4R)-4-[(E,3R,4R,5R,6R)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3,5-dihydroxy-2,4,6-trimethyl-7-oxohept-1-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 52916329) has the molecular formula C30H44N2O8 and a molecular weight of 560.69 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(E,3R,4R,5R,6R)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3,5-dihydroxy-2,4,6-trimethyl-7-oxohept-1-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(E,3R,4R,5R,6R)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3,5-dihydroxy-2,4,6-trimethyl-7-oxohept-1-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 52916329 |
| Molecular Formula | C30H44N2O8 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | tert-butyl (4R)-4-[(E,3R,4R,5R,6R)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3,5-dihydroxy-2,4,6-trimethyl-7-oxohept-1-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C/C(=C\[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C)[C@H](O)[C@H](C)[C@@H](O)[C@@H](C)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C30H44N2O8/c1-18(14-23-17-39-30(7,8)32(23)28(37)40-29(4,5)6)24(33)19(2)25(34)20(3)26(35)31-22(16-38-27(31)36)15-21-12-10-9-11-13-21/h9-14,19-20,22-25,33-34H,15-17H2,1-8H3/b18-14+/t19-,20+,22-,23+,24-,25+/m0/s1 |
| InChIKey | BIHXWTGMEGDJLL-PPIDHZEXSA-N |
| XLogP | 3.89 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|