C29H32O6S — CID 52918466
[(2R,3R,4R,5R,6S)-5-hydroxy-6-(4-methylphenyl)sulfanyl-3,4-bis(phenylmethoxy)oxan-2-yl]methyl acetate (PubChem CID 52918466) has the molecular formula C29H32O6S and a molecular weight of 508.64 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-5-hydroxy-6-(4-methylphenyl)sulfanyl-3,4-bis(phenylmethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6S)-5-hydroxy-6-(4-methylphenyl)sulfanyl-3,4-bis(phenylmethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 52918466 |
| Molecular Formula | C29H32O6S |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-5-hydroxy-6-(4-methylphenyl)sulfanyl-3,4-bis(phenylmethoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Sc2ccc(C)cc2)[C@H](O)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H32O6S/c1-20-13-15-24(16-14-20)36-29-26(31)28(34-18-23-11-7-4-8-12-23)27(25(35-29)19-32-21(2)30)33-17-22-9-5-3-6-10-22/h3-16,25-29,31H,17-19H2,1-2H3/t25-,26-,27-,28-,29+/m1/s1 |
| InChIKey | KOPCEYMWWACUTR-JPHCZMGXSA-N |
| XLogP | 4.91 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |