C21H31N3O2 — CID 52919592
(2S)-2-amino-3-methyl-N-[5-(3-piperidin-4-yloxyphenyl)pent-4-ynyl]butanamide (PubChem CID 52919592) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-N-[5-(3-piperidin-4-yloxyphenyl)pent-4-ynyl]butanamide.
| Compound Name | (2S)-2-amino-3-methyl-N-[5-(3-piperidin-4-yloxyphenyl)pent-4-ynyl]butanamide |
|---|---|
| PubChem CID | 52919592 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | (2S)-2-amino-3-methyl-N-[5-(3-piperidin-4-yloxyphenyl)pent-4-ynyl]butanamide |
| SMILES | CC(C)[C@H](N)C(=O)NCCCC#Cc1cccc(OC2CCNCC2)c1 |
| InChI | InChI=1S/C21H31N3O2/c1-16(2)20(22)21(25)24-12-5-3-4-7-17-8-6-9-19(15-17)26-18-10-13-23-14-11-18/h6,8-9,15-16,18,20,23H,3,5,10-14,22H2,1-2H3,(H,24,25)/t20-/m0/s1 |
| InChIKey | VLPUFAZFKNLKER-FQEVSTJZSA-N |
| XLogP | 2.05 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|