C17H12F4N2O4 — CID 52919931
N-(2-aminophenyl)-5,6-bis(difluoromethoxy)-1-benzofuran-2-carboxamide (PubChem CID 52919931) has the molecular formula C17H12F4N2O4 and a molecular weight of 384.29 g/mol. Its IUPAC name is N-(2-aminophenyl)-5,6-bis(difluoromethoxy)-1-benzofuran-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-5,6-bis(difluoromethoxy)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 52919931 |
| Molecular Formula | C17H12F4N2O4 |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | N-(2-aminophenyl)-5,6-bis(difluoromethoxy)-1-benzofuran-2-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1cc2cc(OC(F)F)c(OC(F)F)cc2o1 |
| InChI | InChI=1S/C17H12F4N2O4/c18-16(19)26-12-5-8-6-14(25-11(8)7-13(12)27-17(20)21)15(24)23-10-4-2-1-3-9(10)22/h1-7,16-17H,22H2,(H,23,24) |
| InChIKey | FYTUTQFUGQUFLS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|