About 3-ethyl-3-propyloxetane
3-ethyl-3-propyloxetane (PubChem CID 529313) has the molecular formula C8H16O
and a molecular weight of 128.22 g/mol. Its IUPAC name is 3-ethyl-3-propyloxetane.
Molecular Properties
| Compound Name | 3-ethyl-3-propyloxetane |
| PubChem CID | 529313 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | 3-ethyl-3-propyloxetane |
| SMILES | CCCC1(CC)COC1 |
| InChI | InChI=1S/C8H16O/c1-3-5-8(4-2)6-9-7-8/h3-7H2,1-2H3 |
| InChIKey | HAJCTSOSULRGRA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-3-propyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-3-propyloxetane?
The IUPAC name of 3-ethyl-3-propyloxetane (CID 529313) is 3-ethyl-3-propyloxetane.
What is the SMILES notation for 3-ethyl-3-propyloxetane?
The canonical SMILES for 3-ethyl-3-propyloxetane is CCCC1(CC)COC1.
What is the InChIKey of 3-ethyl-3-propyloxetane?
The InChIKey is HAJCTSOSULRGRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O/c1-3-5-8(4-2)6-9-7-8/h3-7H2,1-2H3.
What are the key properties of 3-ethyl-3-propyloxetane?
3-ethyl-3-propyloxetane has a molecular weight of 128.22 g/mol, XLogP of 2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-3-propyloxetane is sourced from PubChem (CID 529313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).