C19H16F3NO4 — CID 52933447
ethyl 2-[2-oxo-5-[3-(trifluoromethoxy)phenyl]-3H-indol-1-yl]acetate (PubChem CID 52933447) has the molecular formula C19H16F3NO4 and a molecular weight of 379.33 g/mol. Its IUPAC name is ethyl 2-[2-oxo-5-[3-(trifluoromethoxy)phenyl]-3H-indol-1-yl]acetate.
| Compound Name | ethyl 2-[2-oxo-5-[3-(trifluoromethoxy)phenyl]-3H-indol-1-yl]acetate |
|---|---|
| PubChem CID | 52933447 |
| Molecular Formula | C19H16F3NO4 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | ethyl 2-[2-oxo-5-[3-(trifluoromethoxy)phenyl]-3H-indol-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)Cc2cc(-c3cccc(OC(F)(F)F)c3)ccc21 |
| InChI | InChI=1S/C19H16F3NO4/c1-2-26-18(25)11-23-16-7-6-13(8-14(16)10-17(23)24)12-4-3-5-15(9-12)27-19(20,21)22/h3-9H,2,10-11H2,1H3 |
| InChIKey | WXUGPDIOTYCDLZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |