C16H13F3N2O3 — CID 68786297
3-amino-1-hydroxy-7-[3-(trifluoromethoxy)phenyl]-3,4-dihydroquinolin-2-one (PubChem CID 68786297) has the molecular formula C16H13F3N2O3 and a molecular weight of 338.29 g/mol. Its IUPAC name is 3-amino-1-hydroxy-7-[3-(trifluoromethoxy)phenyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 3-amino-1-hydroxy-7-[3-(trifluoromethoxy)phenyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 68786297 |
| Molecular Formula | C16H13F3N2O3 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 3-amino-1-hydroxy-7-[3-(trifluoromethoxy)phenyl]-3,4-dihydroquinolin-2-one |
| SMILES | NC1Cc2ccc(-c3cccc(OC(F)(F)F)c3)cc2N(O)C1=O |
| InChI | InChI=1S/C16H13F3N2O3/c17-16(18,19)24-12-3-1-2-9(6-12)10-4-5-11-7-13(20)15(22)21(23)14(11)8-10/h1-6,8,13,23H,7,20H2 |
| InChIKey | ZCRRNDITLJXXLL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|