C28H30N8O6 — CID 52933584
(E)-but-2-enedioic acid;4-[8-[4-(5-propan-2-yl-2,5-diazabicyclo[2.2.1]heptan-2-yl)anilino]-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]furan-2-carboxamide (PubChem CID 52933584) has the molecular formula C28H30N8O6 and a molecular weight of 574.60 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;4-[8-[4-(5-propan-2-yl-2,5-diazabicyclo[2.2.1]heptan-2-yl)anilino]-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]furan-2-carboxamide.
| Compound Name | (E)-but-2-enedioic acid;4-[8-[4-(5-propan-2-yl-2,5-diazabicyclo[2.2.1]heptan-2-yl)anilino]-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 52933584 |
| Molecular Formula | C28H30N8O6 |
| Molecular Weight | 574.60 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | (E)-but-2-enedioic acid;4-[8-[4-(5-propan-2-yl-2,5-diazabicyclo[2.2.1]heptan-2-yl)anilino]-[1,2,4]triazolo[1,5-a]pyrazin-5-yl]furan-2-carboxamide |
| SMILES | CC(C)N1CC2CC1CN2c1ccc(Nc2ncc(-c3coc(C(N)=O)c3)n3ncnc23)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C24H26N8O2.C4H4O4/c1-14(2)30-10-19-8-18(30)11-31(19)17-5-3-16(4-6-17)29-23-24-27-13-28-32(24)20(9-26-23)15-7-21(22(25)33)34-12-15;5-3(6)1-2-4(7)8/h3-7,9,12-14,18-19H,8,10-11H2,1-2H3,(H2,25,33)(H,26,29);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | BDKQUWHANYQBBR-WLHGVMLRSA-N |
| XLogP | 2.61 |
| TPSA | 192.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.60 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|