C17H24N4O4 — CID 52935934
ethyl 2-[(8-cyclopentyl-6-oxo-1-propyl-7H-purin-2-yl)oxy]acetate (PubChem CID 52935934) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is ethyl 2-[(8-cyclopentyl-6-oxo-1-propyl-7H-purin-2-yl)oxy]acetate.
| Compound Name | ethyl 2-[(8-cyclopentyl-6-oxo-1-propyl-7H-purin-2-yl)oxy]acetate |
|---|---|
| PubChem CID | 52935934 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | ethyl 2-[(8-cyclopentyl-6-oxo-1-propyl-7H-purin-2-yl)oxy]acetate |
| SMILES | CCCn1c(OCC(=O)OCC)nc2nc(C3CCCC3)[nH]c2c1=O |
| InChI | InChI=1S/C17H24N4O4/c1-3-9-21-16(23)13-15(19-14(18-13)11-7-5-6-8-11)20-17(21)25-10-12(22)24-4-2/h11H,3-10H2,1-2H3,(H,18,19) |
| InChIKey | ICGLIOPOZOAJJI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |