C24H28N6O2 — CID 52938646
(E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-cyano-N,N-diethylprop-2-enamide (PubChem CID 52938646) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is (E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-cyano-N,N-diethylprop-2-enamide.
| Compound Name | (E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-cyano-N,N-diethylprop-2-enamide |
|---|---|
| PubChem CID | 52938646 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | (E)-3-[4-amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-6-yl]-2-cyano-N,N-diethylprop-2-enamide |
| SMILES | CCN(CC)C(=O)/C(C#N)=C/c1c(-c2ccc(C)cc2)c2c(N)ncnc2n1CCCO |
| InChI | InChI=1S/C24H28N6O2/c1-4-29(5-2)24(32)18(14-25)13-19-20(17-9-7-16(3)8-10-17)21-22(26)27-15-28-23(21)30(19)11-6-12-31/h7-10,13,15,31H,4-6,11-12H2,1-3H3,(H2,26,27,28)/b18-13+ |
| InChIKey | YTTVLNBTJVEKRY-QGOAFFKASA-N |
| XLogP | 3.15 |
| TPSA | 121.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|