C16H27N3OS — CID 52941311
5-ethyl-2-(3-piperidin-1-ylpropoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine (PubChem CID 52941311) has the molecular formula C16H27N3OS and a molecular weight of 309.48 g/mol. Its IUPAC name is 5-ethyl-2-(3-piperidin-1-ylpropoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine.
| Compound Name | 5-ethyl-2-(3-piperidin-1-ylpropoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 52941311 |
| Molecular Formula | C16H27N3OS |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 5-ethyl-2-(3-piperidin-1-ylpropoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine |
| SMILES | CCN1CCc2sc(OCCCN3CCCCC3)nc2C1 |
| InChI | InChI=1S/C16H27N3OS/c1-2-18-11-7-15-14(13-18)17-16(21-15)20-12-6-10-19-8-4-3-5-9-19/h2-13H2,1H3 |
| InChIKey | UJAWLZVSAZQXGG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|