C15H25N3OS — CID 52941318
5-methyl-2-(3-piperidin-1-ylpropoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine (PubChem CID 52941318) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is 5-methyl-2-(3-piperidin-1-ylpropoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine.
| Compound Name | 5-methyl-2-(3-piperidin-1-ylpropoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 52941318 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 5-methyl-2-(3-piperidin-1-ylpropoxy)-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine |
| SMILES | CN1CCc2sc(OCCCN3CCCCC3)nc2C1 |
| InChI | InChI=1S/C15H25N3OS/c1-17-10-6-14-13(12-17)16-15(20-14)19-11-5-9-18-7-3-2-4-8-18/h2-12H2,1H3 |
| InChIKey | JMPPTODNHHWTMD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|