C9H12ClN3 — CID 52942945
N-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride (PubChem CID 52942945) has the molecular formula C9H12ClN3 and a molecular weight of 197.67 g/mol. Its IUPAC name is N-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride.
| Compound Name | N-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 52942945 |
| Molecular Formula | C9H12ClN3 |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | N-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride |
| SMILES | Cl.c1ccc(NC2=NCCN2)cc1 |
| InChI | InChI=1S/C9H11N3.ClH/c1-2-4-8(5-3-1)12-9-10-6-7-11-9;/h1-5H,6-7H2,(H2,10,11,12);1H |
| InChIKey | PFRNBEPKERESDS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |