About N-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride
N-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride (PubChem CID 52942945) has the molecular formula C9H12ClN3
and a molecular weight of 197.67 g/mol. Its IUPAC name is N-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | N-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride |
| PubChem CID | 52942945 |
| Molecular Formula | C9H12ClN3 |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | N-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride |
| SMILES | Cl.c1ccc(NC2=NCCN2)cc1 |
| InChI | InChI=1S/C9H11N3.ClH/c1-2-4-8(5-3-1)12-9-10-6-7-11-9;/h1-5H,6-7H2,(H2,10,11,12);1H |
| InChIKey | PFRNBEPKERESDS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride?
The IUPAC name of N-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride (CID 52942945) is N-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride.
What is the SMILES notation for N-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride?
The canonical SMILES for N-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride is Cl.c1ccc(NC2=NCCN2)cc1.
What is the InChIKey of N-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride?
The InChIKey is PFRNBEPKERESDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3.ClH/c1-2-4-8(5-3-1)12-9-10-6-7-11-9;/h1-5H,6-7H2,(H2,10,11,12);1H.
What are the key properties of N-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride?
N-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride has a molecular weight of 197.67 g/mol, XLogP of 1.48, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydrochloride is sourced from PubChem (CID 52942945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).