C25H32F2N2O3 — CID 52944538
(2S,4R)-4-(4-fluorophenyl)-2-[2-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]ethyl]-N-hydroxy-4-methoxybutanamide (PubChem CID 52944538) has the molecular formula C25H32F2N2O3 and a molecular weight of 446.54 g/mol. Its IUPAC name is (2S,4R)-4-(4-fluorophenyl)-2-[2-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]ethyl]-N-hydroxy-4-methoxybutanamide.
| Compound Name | (2S,4R)-4-(4-fluorophenyl)-2-[2-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]ethyl]-N-hydroxy-4-methoxybutanamide |
|---|---|
| PubChem CID | 52944538 |
| Molecular Formula | C25H32F2N2O3 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | (2S,4R)-4-(4-fluorophenyl)-2-[2-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]ethyl]-N-hydroxy-4-methoxybutanamide |
| SMILES | CO[C@H](CC(CCN1CCCC(Cc2ccc(F)cc2)C1)C(=O)NO)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H32F2N2O3/c1-32-24(20-6-10-23(27)11-7-20)16-21(25(30)28-31)12-14-29-13-2-3-19(17-29)15-18-4-8-22(26)9-5-18/h4-11,19,21,24,31H,2-3,12-17H2,1H3,(H,28,30)/t19?,21?,24-/m1/s1 |
| InChIKey | ONYBLJQFZWDCRC-NFDBJIOVSA-N |
| XLogP | 4.51 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|