C26H21N5O3 — CID 52947076
[2-[[2-(2,3-dihydro-1H-inden-5-ylamino)-5-nitropyrimidin-4-yl]amino]phenyl]-phenylmethanone (PubChem CID 52947076) has the molecular formula C26H21N5O3 and a molecular weight of 451.49 g/mol. Its IUPAC name is [2-[[2-(2,3-dihydro-1H-inden-5-ylamino)-5-nitropyrimidin-4-yl]amino]phenyl]-phenylmethanone.
| Compound Name | [2-[[2-(2,3-dihydro-1H-inden-5-ylamino)-5-nitropyrimidin-4-yl]amino]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 52947076 |
| Molecular Formula | C26H21N5O3 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | [2-[[2-(2,3-dihydro-1H-inden-5-ylamino)-5-nitropyrimidin-4-yl]amino]phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccccc1Nc1nc(Nc2ccc3c(c2)CCC3)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H21N5O3/c32-24(18-7-2-1-3-8-18)21-11-4-5-12-22(21)29-25-23(31(33)34)16-27-26(30-25)28-20-14-13-17-9-6-10-19(17)15-20/h1-5,7-8,11-16H,6,9-10H2,(H2,27,28,29,30) |
| InChIKey | MJXSZJORWUAZJM-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|