C20H24N2O — CID 52947282
2-(17-methoxy-1-azatetracyclo[11.5.0.02,7.07,12]octadeca-2,9,11,13,15,17-hexaen-15-yl)ethanamine (PubChem CID 52947282) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is 2-(17-methoxy-1-azatetracyclo[11.5.0.02,7.07,12]octadeca-2,9,11,13,15,17-hexaen-15-yl)ethanamine.
| Compound Name | 2-(17-methoxy-1-azatetracyclo[11.5.0.02,7.07,12]octadeca-2,9,11,13,15,17-hexaen-15-yl)ethanamine |
|---|---|
| PubChem CID | 52947282 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 2-(17-methoxy-1-azatetracyclo[11.5.0.02,7.07,12]octadeca-2,9,11,13,15,17-hexaen-15-yl)ethanamine |
| SMILES | COC1=CN2C(=CC(CCN)=C1)C1=CC=CCC13CCCC=C23 |
| InChI | InChI=1S/C20H24N2O/c1-23-16-12-15(8-11-21)13-18-17-6-2-4-9-20(17)10-5-3-7-19(20)22(18)14-16/h2,4,6-7,12-14H,3,5,8-11,21H2,1H3 |
| InChIKey | ACGNSLWUBIIPAC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |