C17H21IN2O — CID 138396852
8-methoxy-3-methyl-4,6a,6b,10a,11,11a-hexahydropyrido[4,3-a]carbazole;hydroiodide (PubChem CID 138396852) has the molecular formula C17H21IN2O and a molecular weight of 396.27 g/mol. Its IUPAC name is 8-methoxy-3-methyl-4,6a,6b,10a,11,11a-hexahydropyrido[4,3-a]carbazole;hydroiodide.
| Compound Name | 8-methoxy-3-methyl-4,6a,6b,10a,11,11a-hexahydropyrido[4,3-a]carbazole;hydroiodide |
|---|---|
| PubChem CID | 138396852 |
| Molecular Formula | C17H21IN2O |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 8-methoxy-3-methyl-4,6a,6b,10a,11,11a-hexahydropyrido[4,3-a]carbazole;hydroiodide |
| SMILES | COC1=CC2C(C=C1)NC1C3=C(C=CC12)CN(C)C=C3.I |
| InChI | InChI=1S/C17H20N2O.HI/c1-19-8-7-13-11(10-19)3-5-14-15-9-12(20-2)4-6-16(15)18-17(13)14;/h3-9,14-18H,10H2,1-2H3;1H |
| InChIKey | UTYDSNGKAXCODN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|