C20H13F3N2O5 — CID 5294750
4-(3-nitrophenyl)-1-[3-(trifluoromethyl)phenyl]-4,7-dihydro-3H-furo[3,4-b]pyridine-2,5-dione (PubChem CID 5294750) has the molecular formula C20H13F3N2O5 and a molecular weight of 418.33 g/mol. Its IUPAC name is 4-(3-nitrophenyl)-1-[3-(trifluoromethyl)phenyl]-4,7-dihydro-3H-furo[3,4-b]pyridine-2,5-dione.
| Compound Name | 4-(3-nitrophenyl)-1-[3-(trifluoromethyl)phenyl]-4,7-dihydro-3H-furo[3,4-b]pyridine-2,5-dione |
|---|---|
| PubChem CID | 5294750 |
| Molecular Formula | C20H13F3N2O5 |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 4-(3-nitrophenyl)-1-[3-(trifluoromethyl)phenyl]-4,7-dihydro-3H-furo[3,4-b]pyridine-2,5-dione |
| SMILES | O=C1OCC2=C1C(c1cccc([N+](=O)[O-])c1)CC(=O)N2c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H13F3N2O5/c21-20(22,23)12-4-2-5-13(8-12)24-16-10-30-19(27)18(16)15(9-17(24)26)11-3-1-6-14(7-11)25(28)29/h1-8,15H,9-10H2 |
| InChIKey | QHAWXEAHTAPFHY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|