C30H40INO6 — CID 52949645
[2-[[[2-(4-acetyloxy-3-iodo-5-methoxyphenyl)acetyl]amino]methyl]-3-(4-tert-butylphenyl)propyl] 2,2-dimethylpropanoate (PubChem CID 52949645) has the molecular formula C30H40INO6 and a molecular weight of 637.56 g/mol. Its IUPAC name is [2-[[[2-(4-acetyloxy-3-iodo-5-methoxyphenyl)acetyl]amino]methyl]-3-(4-tert-butylphenyl)propyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[[[2-(4-acetyloxy-3-iodo-5-methoxyphenyl)acetyl]amino]methyl]-3-(4-tert-butylphenyl)propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 52949645 |
| Molecular Formula | C30H40INO6 |
| Molecular Weight | 637.56 g/mol |
| Exact Mass | 637.19 |
| IUPAC Name | [2-[[[2-(4-acetyloxy-3-iodo-5-methoxyphenyl)acetyl]amino]methyl]-3-(4-tert-butylphenyl)propyl] 2,2-dimethylpropanoate |
| SMILES | COc1cc(CC(=O)NCC(COC(=O)C(C)(C)C)Cc2ccc(C(C)(C)C)cc2)cc(I)c1OC(C)=O |
| InChI | InChI=1S/C30H40INO6/c1-19(33)38-27-24(31)14-21(15-25(27)36-8)16-26(34)32-17-22(18-37-28(35)30(5,6)7)13-20-9-11-23(12-10-20)29(2,3)4/h9-12,14-15,22H,13,16-18H2,1-8H3,(H,32,34) |
| InChIKey | FEWALVDCMIKQBW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|