C27H36Br2N2O3 — CID 52943142
[2-[[[2-(4-amino-3,5-dibromophenyl)acetyl]amino]methyl]-3-(4-tert-butylphenyl)propyl] 2,2-dimethylpropanoate (PubChem CID 52943142) has the molecular formula C27H36Br2N2O3 and a molecular weight of 596.40 g/mol. Its IUPAC name is [2-[[[2-(4-amino-3,5-dibromophenyl)acetyl]amino]methyl]-3-(4-tert-butylphenyl)propyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[[[2-(4-amino-3,5-dibromophenyl)acetyl]amino]methyl]-3-(4-tert-butylphenyl)propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 52943142 |
| Molecular Formula | C27H36Br2N2O3 |
| Molecular Weight | 596.40 g/mol |
| Exact Mass | 594.11 |
| IUPAC Name | [2-[[[2-(4-amino-3,5-dibromophenyl)acetyl]amino]methyl]-3-(4-tert-butylphenyl)propyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC(CNC(=O)Cc1cc(Br)c(N)c(Br)c1)Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H36Br2N2O3/c1-26(2,3)20-9-7-17(8-10-20)11-19(16-34-25(33)27(4,5)6)15-31-23(32)14-18-12-21(28)24(30)22(29)13-18/h7-10,12-13,19H,11,14-16,30H2,1-6H3,(H,31,32) |
| InChIKey | RPJVAQLXHXMPQL-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.40 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|