C11H11Br2NO3 — CID 68854381
methyl 4-(4-amino-3,5-dibromophenyl)-3-oxobutanoate (PubChem CID 68854381) has the molecular formula C11H11Br2NO3 and a molecular weight of 365.02 g/mol. Its IUPAC name is methyl 4-(4-amino-3,5-dibromophenyl)-3-oxobutanoate.
| Compound Name | methyl 4-(4-amino-3,5-dibromophenyl)-3-oxobutanoate |
|---|---|
| PubChem CID | 68854381 |
| Molecular Formula | C11H11Br2NO3 |
| Molecular Weight | 365.02 g/mol |
| Exact Mass | 362.91 |
| IUPAC Name | methyl 4-(4-amino-3,5-dibromophenyl)-3-oxobutanoate |
| SMILES | COC(=O)CC(=O)Cc1cc(Br)c(N)c(Br)c1 |
| InChI | InChI=1S/C11H11Br2NO3/c1-17-10(16)5-7(15)2-6-3-8(12)11(14)9(13)4-6/h3-4H,2,5,14H2,1H3 |
| InChIKey | MQESKLOHBFMINB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.02 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|