C11H18FN3 — CID 52951947
N'-ethyl-N'-[2-(2-fluoro-4-pyridinyl)ethyl]ethane-1,2-diamine (PubChem CID 52951947) has the molecular formula C11H18FN3 and a molecular weight of 211.28 g/mol. Its IUPAC name is N'-ethyl-N'-[2-(2-fluoro-4-pyridinyl)ethyl]ethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-[2-(2-fluoro-4-pyridinyl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 52951947 |
| Molecular Formula | C11H18FN3 |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.15 |
| IUPAC Name | N'-ethyl-N'-[2-(2-fluoro-4-pyridinyl)ethyl]ethane-1,2-diamine |
| SMILES | CCN(CCN)CCc1ccnc(F)c1 |
| InChI | InChI=1S/C11H18FN3/c1-2-15(8-5-13)7-4-10-3-6-14-11(12)9-10/h3,6,9H,2,4-5,7-8,13H2,1H3 |
| InChIKey | CTTASVILNLZVHW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|