C16H12N6OS — CID 5295384
4,7-diamino-2-prop-2-ynylsulfanyl-5-pyridin-3-yl-5H-pyrano[2,3-d]pyrimidine-6-carbonitrile (PubChem CID 5295384) has the molecular formula C16H12N6OS and a molecular weight of 336.38 g/mol. Its IUPAC name is 4,7-diamino-2-prop-2-ynylsulfanyl-5-pyridin-3-yl-5H-pyrano[2,3-d]pyrimidine-6-carbonitrile.
| Compound Name | 4,7-diamino-2-prop-2-ynylsulfanyl-5-pyridin-3-yl-5H-pyrano[2,3-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 5295384 |
| Molecular Formula | C16H12N6OS |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 4,7-diamino-2-prop-2-ynylsulfanyl-5-pyridin-3-yl-5H-pyrano[2,3-d]pyrimidine-6-carbonitrile |
| SMILES | C#CCSc1nc(N)c2c(n1)OC(N)=C(C#N)C2c1cccnc1 |
| InChI | InChI=1S/C16H12N6OS/c1-2-6-24-16-21-13(18)12-11(9-4-3-5-20-8-9)10(7-17)14(19)23-15(12)22-16/h1,3-5,8,11H,6,19H2,(H2,18,21,22) |
| InChIKey | ISCIEXGQHZZFNE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|