C17H12FN5OS — CID 7298475
(5R)-4,7-diamino-5-(3-fluorophenyl)-2-prop-2-ynylsulfanyl-5H-pyrano[2,3-d]pyrimidine-6-carbonitrile (PubChem CID 7298475) has the molecular formula C17H12FN5OS and a molecular weight of 353.38 g/mol. Its IUPAC name is (5R)-4,7-diamino-5-(3-fluorophenyl)-2-prop-2-ynylsulfanyl-5H-pyrano[2,3-d]pyrimidine-6-carbonitrile.
| Compound Name | (5R)-4,7-diamino-5-(3-fluorophenyl)-2-prop-2-ynylsulfanyl-5H-pyrano[2,3-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 7298475 |
| Molecular Formula | C17H12FN5OS |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | (5R)-4,7-diamino-5-(3-fluorophenyl)-2-prop-2-ynylsulfanyl-5H-pyrano[2,3-d]pyrimidine-6-carbonitrile |
| SMILES | C#CCSc1nc(N)c2c(n1)OC(N)=C(C#N)[C@H]2c1cccc(F)c1 |
| InChI | InChI=1S/C17H12FN5OS/c1-2-6-25-17-22-14(20)13-12(9-4-3-5-10(18)7-9)11(8-19)15(21)24-16(13)23-17/h1,3-5,7,12H,6,21H2,(H2,20,22,23)/t12-/m1/s1 |
| InChIKey | LWSTYEFXLCIYPR-GFCCVEGCSA-N |
| XLogP | 2.14 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|