C17H13N5OS — CID 7298627
(5R)-4,7-diamino-5-phenyl-2-prop-2-ynylsulfanyl-5H-pyrano[2,3-d]pyrimidine-6-carbonitrile (PubChem CID 7298627) has the molecular formula C17H13N5OS and a molecular weight of 335.39 g/mol. Its IUPAC name is (5R)-4,7-diamino-5-phenyl-2-prop-2-ynylsulfanyl-5H-pyrano[2,3-d]pyrimidine-6-carbonitrile.
| Compound Name | (5R)-4,7-diamino-5-phenyl-2-prop-2-ynylsulfanyl-5H-pyrano[2,3-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 7298627 |
| Molecular Formula | C17H13N5OS |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | (5R)-4,7-diamino-5-phenyl-2-prop-2-ynylsulfanyl-5H-pyrano[2,3-d]pyrimidine-6-carbonitrile |
| SMILES | C#CCSc1nc(N)c2c(n1)OC(N)=C(C#N)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C17H13N5OS/c1-2-8-24-17-21-14(19)13-12(10-6-4-3-5-7-10)11(9-18)15(20)23-16(13)22-17/h1,3-7,12H,8,20H2,(H2,19,21,22)/t12-/m1/s1 |
| InChIKey | WLYXUOQLLYNRQF-GFCCVEGCSA-N |
| XLogP | 2.00 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|