C16H20N4O2S2 — CID 52956594
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(4-oxo-4a,5,6,7,8,8a-hexahydro-1,3-benzothiazin-2-yl)acetamide (PubChem CID 52956594) has the molecular formula C16H20N4O2S2 and a molecular weight of 364.50 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(4-oxo-4a,5,6,7,8,8a-hexahydro-1,3-benzothiazin-2-yl)acetamide.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(4-oxo-4a,5,6,7,8,8a-hexahydro-1,3-benzothiazin-2-yl)acetamide |
|---|---|
| PubChem CID | 52956594 |
| Molecular Formula | C16H20N4O2S2 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(4-oxo-4a,5,6,7,8,8a-hexahydro-1,3-benzothiazin-2-yl)acetamide |
| SMILES | Cc1cc(C)nc(SCC(=O)NC2=NC(=O)C3CCCCC3S2)n1 |
| InChI | InChI=1S/C16H20N4O2S2/c1-9-7-10(2)18-15(17-9)23-8-13(21)19-16-20-14(22)11-5-3-4-6-12(11)24-16/h7,11-12H,3-6,8H2,1-2H3,(H,19,20,21,22) |
| InChIKey | HHBWTMYGADHXQL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |