C15H22N4OS — CID 42996055
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-(2-methylcyclohexylidene)amino]acetamide (PubChem CID 42996055) has the molecular formula C15H22N4OS and a molecular weight of 306.44 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-(2-methylcyclohexylidene)amino]acetamide.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-(2-methylcyclohexylidene)amino]acetamide |
|---|---|
| PubChem CID | 42996055 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-(2-methylcyclohexylidene)amino]acetamide |
| SMILES | Cc1cc(C)nc(SCC(=O)N/N=C2/CCCCC2C)n1 |
| InChI | InChI=1S/C15H22N4OS/c1-10-6-4-5-7-13(10)18-19-14(20)9-21-15-16-11(2)8-12(3)17-15/h8,10H,4-7,9H2,1-3H3,(H,19,20)/b18-13- |
| InChIKey | DWCFFCKPNWEMCM-AQTBWJFISA-N |
| XLogP | 2.87 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|