C15H11N3O5S — CID 5296564
N-(2-methoxyphenyl)-2,5-dinitro-1-benzothiophen-3-amine (PubChem CID 5296564) has the molecular formula C15H11N3O5S and a molecular weight of 345.34 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2,5-dinitro-1-benzothiophen-3-amine.
| Compound Name | N-(2-methoxyphenyl)-2,5-dinitro-1-benzothiophen-3-amine |
|---|---|
| PubChem CID | 5296564 |
| Molecular Formula | C15H11N3O5S |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | N-(2-methoxyphenyl)-2,5-dinitro-1-benzothiophen-3-amine |
| SMILES | COc1ccccc1Nc1c([N+](=O)[O-])sc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C15H11N3O5S/c1-23-12-5-3-2-4-11(12)16-14-10-8-9(17(19)20)6-7-13(10)24-15(14)18(21)22/h2-8,16H,1H3 |
| InChIKey | RRKQFDRRYVDQOO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|