C15H12N2O2S2 — CID 5297946
(7aR)-6-phenyl-3-thiophen-2-yl-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione (PubChem CID 5297946) has the molecular formula C15H12N2O2S2 and a molecular weight of 316.41 g/mol. Its IUPAC name is (7aR)-6-phenyl-3-thiophen-2-yl-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione.
| Compound Name | (7aR)-6-phenyl-3-thiophen-2-yl-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione |
|---|---|
| PubChem CID | 5297946 |
| Molecular Formula | C15H12N2O2S2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | (7aR)-6-phenyl-3-thiophen-2-yl-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione |
| SMILES | O=C1[C@@H]2CSC(c3cccs3)N2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C15H12N2O2S2/c18-13-11-9-21-14(12-7-4-8-20-12)17(11)15(19)16(13)10-5-2-1-3-6-10/h1-8,11,14H,9H2/t11-,14?/m0/s1 |
| InChIKey | RHQSYROQZIPAOE-ZSOXZCCMSA-N |
| XLogP | 3.33 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|