C19H19BrN2OS2 — CID 5298315
1-(5-bromothiophen-2-yl)-2-(1-cyclohexylbenzimidazol-2-yl)sulfanylethanone (PubChem CID 5298315) has the molecular formula C19H19BrN2OS2 and a molecular weight of 435.41 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-2-(1-cyclohexylbenzimidazol-2-yl)sulfanylethanone.
| Compound Name | 1-(5-bromothiophen-2-yl)-2-(1-cyclohexylbenzimidazol-2-yl)sulfanylethanone |
|---|---|
| PubChem CID | 5298315 |
| Molecular Formula | C19H19BrN2OS2 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-2-(1-cyclohexylbenzimidazol-2-yl)sulfanylethanone |
| SMILES | O=C(CSc1nc2ccccc2n1C1CCCCC1)c1ccc(Br)s1 |
| InChI | InChI=1S/C19H19BrN2OS2/c20-18-11-10-17(25-18)16(23)12-24-19-21-14-8-4-5-9-15(14)22(19)13-6-2-1-3-7-13/h4-5,8-11,13H,1-3,6-7,12H2 |
| InChIKey | PRWXUAHHPZOLLJ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |