C21H19BrN2O2S — CID 23996409
2-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-1-cyclopentylquinazolin-4-one (PubChem CID 23996409) has the molecular formula C21H19BrN2O2S and a molecular weight of 443.37 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-1-cyclopentylquinazolin-4-one.
| Compound Name | 2-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-1-cyclopentylquinazolin-4-one |
|---|---|
| PubChem CID | 23996409 |
| Molecular Formula | C21H19BrN2O2S |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 2-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-1-cyclopentylquinazolin-4-one |
| SMILES | O=C(CSc1nc(=O)c2ccccc2n1C1CCCC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H19BrN2O2S/c22-15-11-9-14(10-12-15)19(25)13-27-21-23-20(26)17-7-3-4-8-18(17)24(21)16-5-1-2-6-16/h3-4,7-12,16H,1-2,5-6,13H2 |
| InChIKey | QUQZKEPHODIHOP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |