C22H21BrN2O2S — CID 2865024
2-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-3-(cyclopentylmethyl)quinazolin-4-one (PubChem CID 2865024) has the molecular formula C22H21BrN2O2S and a molecular weight of 457.39 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-3-(cyclopentylmethyl)quinazolin-4-one.
| Compound Name | 2-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-3-(cyclopentylmethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 2865024 |
| Molecular Formula | C22H21BrN2O2S |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 2-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-3-(cyclopentylmethyl)quinazolin-4-one |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1CC1CCCC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H21BrN2O2S/c23-17-11-9-16(10-12-17)20(26)14-28-22-24-19-8-4-3-7-18(19)21(27)25(22)13-15-5-1-2-6-15/h3-4,7-12,15H,1-2,5-6,13-14H2 |
| InChIKey | XXAMQVPKRGWVFK-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |