C15H16N2O3S — CID 43298853
2-[3-(cyclobutylmethyl)-4-oxoquinazolin-2-yl]sulfanylacetic acid (PubChem CID 43298853) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is 2-[3-(cyclobutylmethyl)-4-oxoquinazolin-2-yl]sulfanylacetic acid.
| Compound Name | 2-[3-(cyclobutylmethyl)-4-oxoquinazolin-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 43298853 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-[3-(cyclobutylmethyl)-4-oxoquinazolin-2-yl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1nc2ccccc2c(=O)n1CC1CCC1 |
| InChI | InChI=1S/C15H16N2O3S/c18-13(19)9-21-15-16-12-7-2-1-6-11(12)14(20)17(15)8-10-4-3-5-10/h1-2,6-7,10H,3-5,8-9H2,(H,18,19) |
| InChIKey | MFJGFULQWTZIEP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |