C27H31N3O4S — CID 5323147
ethyl 2-[3-[[4-(benzylcarbamoyl)cyclohexyl]methyl]-4-oxoquinazolin-2-yl]sulfanylacetate (PubChem CID 5323147) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is ethyl 2-[3-[[4-(benzylcarbamoyl)cyclohexyl]methyl]-4-oxoquinazolin-2-yl]sulfanylacetate.
| Compound Name | ethyl 2-[3-[[4-(benzylcarbamoyl)cyclohexyl]methyl]-4-oxoquinazolin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 5323147 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | ethyl 2-[3-[[4-(benzylcarbamoyl)cyclohexyl]methyl]-4-oxoquinazolin-2-yl]sulfanylacetate |
| SMILES | CCOC(=O)CSc1nc2ccccc2c(=O)n1CC1CCC(C(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C27H31N3O4S/c1-2-34-24(31)18-35-27-29-23-11-7-6-10-22(23)26(33)30(27)17-20-12-14-21(15-13-20)25(32)28-16-19-8-4-3-5-9-19/h3-11,20-21H,2,12-18H2,1H3,(H,28,32) |
| InChIKey | QIWSYRYFQBEWJG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |