C20H20N4O3S — CID 5298321
2,6-dimethoxy-N-[3-(6-methyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)phenyl]benzamide (PubChem CID 5298321) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[3-(6-methyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)phenyl]benzamide.
| Compound Name | 2,6-dimethoxy-N-[3-(6-methyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 5298321 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2,6-dimethoxy-N-[3-(6-methyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)phenyl]benzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1cccc(-c2nnc3n2CC(C)S3)c1 |
| InChI | InChI=1S/C20H20N4O3S/c1-12-11-24-18(22-23-20(24)28-12)13-6-4-7-14(10-13)21-19(25)17-15(26-2)8-5-9-16(17)27-3/h4-10,12H,11H2,1-3H3,(H,21,25) |
| InChIKey | VYCZNAKJVFHGQO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |