C14H14N6S2 — CID 169361969
methyl N-cyano-N'-[3-(6-methyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)phenyl]carbamimidothioate (PubChem CID 169361969) has the molecular formula C14H14N6S2 and a molecular weight of 330.44 g/mol. Its IUPAC name is methyl N-cyano-N'-[3-(6-methyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[3-(6-methyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169361969 |
| Molecular Formula | C14H14N6S2 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | methyl N-cyano-N'-[3-(6-methyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1cccc(-c2nnc3n2CC(C)S3)c1)NC#N |
| InChI | InChI=1S/C14H14N6S2/c1-9-7-20-12(18-19-14(20)22-9)10-4-3-5-11(6-10)17-13(21-2)16-8-15/h3-6,9H,7H2,1-2H3,(H,16,17) |
| InChIKey | DSFJJBBPJFFPBW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|