About 3-cyclohexyl-1-[4-(5,8-dimethoxy-4-methylquinolin-2-yl)piperazin-1-yl]propan-1-one
3-cyclohexyl-1-[4-(5,8-dimethoxy-4-methylquinolin-2-yl)piperazin-1-yl]propan-1-one (PubChem CID 5298372) has the molecular formula C25H35N3O3
and a molecular weight of 425.57 g/mol. Its IUPAC name is 3-cyclohexyl-1-[4-(5,8-dimethoxy-4-methylquinolin-2-yl)piperazin-1-yl]propan-1-one.
Molecular Properties
| Compound Name | 3-cyclohexyl-1-[4-(5,8-dimethoxy-4-methylquinolin-2-yl)piperazin-1-yl]propan-1-one |
| PubChem CID | 5298372 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | 3-cyclohexyl-1-[4-(5,8-dimethoxy-4-methylquinolin-2-yl)piperazin-1-yl]propan-1-one |
| SMILES | COc1ccc(OC)c2c(C)cc(N3CCN(C(=O)CCC4CCCCC4)CC3)nc12 |
| InChI | InChI=1S/C25H35N3O3/c1-18-17-22(26-25-21(31-3)11-10-20(30-2)24(18)25)27-13-15-28(16-14-27)23(29)12-9-19-7-5-4-6-8-19/h10-11,17,19H,4-9,12-16H2,1-3H3 |
| InChIKey | HEEGKQJOILSFQI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-cyclohexyl-1-[4-(5,8-dimethoxy-4-methylquinolin-2-yl)piperazin-1-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-1-[4-(5,8-dimethoxy-4-methylquinolin-2-yl)piperazin-1-yl]propan-1-one?
The IUPAC name of 3-cyclohexyl-1-[4-(5,8-dimethoxy-4-methylquinolin-2-yl)piperazin-1-yl]propan-1-one (CID 5298372) is 3-cyclohexyl-1-[4-(5,8-dimethoxy-4-methylquinolin-2-yl)piperazin-1-yl]propan-1-one.
What is the SMILES notation for 3-cyclohexyl-1-[4-(5,8-dimethoxy-4-methylquinolin-2-yl)piperazin-1-yl]propan-1-one?
The canonical SMILES for 3-cyclohexyl-1-[4-(5,8-dimethoxy-4-methylquinolin-2-yl)piperazin-1-yl]propan-1-one is COc1ccc(OC)c2c(C)cc(N3CCN(C(=O)CCC4CCCCC4)CC3)nc12.
What is the InChIKey of 3-cyclohexyl-1-[4-(5,8-dimethoxy-4-methylquinolin-2-yl)piperazin-1-yl]propan-1-one?
The InChIKey is HEEGKQJOILSFQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H35N3O3/c1-18-17-22(26-25-21(31-3)11-10-20(30-2)24(18)25)27-13-15-28(16-14-27)23(29)12-9-19-7-5-4-6-8-19/h10-11,17,19H,4-9,12-16H2,1-3H3.
What are the key properties of 3-cyclohexyl-1-[4-(5,8-dimethoxy-4-methylquinolin-2-yl)piperazin-1-yl]propan-1-one?
3-cyclohexyl-1-[4-(5,8-dimethoxy-4-methylquinolin-2-yl)piperazin-1-yl]propan-1-one has a molecular weight of 425.57 g/mol, XLogP of 4.57, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-1-[4-(5,8-dimethoxy-4-methylquinolin-2-yl)piperazin-1-yl]propan-1-one is sourced from PubChem (CID 5298372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).