C22H15BrN2O2S — CID 52988773
2-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione;hydrobromide (PubChem CID 52988773) has the molecular formula C22H15BrN2O2S and a molecular weight of 451.35 g/mol. Its IUPAC name is 2-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione;hydrobromide.
| Compound Name | 2-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione;hydrobromide |
|---|---|
| PubChem CID | 52988773 |
| Molecular Formula | C22H15BrN2O2S |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.00 |
| IUPAC Name | 2-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione;hydrobromide |
| SMILES | Br.O=C1c2ccccc2C(=O)N1Cc1nc(-c2ccc3ccccc3c2)cs1 |
| InChI | InChI=1S/C22H14N2O2S.BrH/c25-21-17-7-3-4-8-18(17)22(26)24(21)12-20-23-19(13-27-20)16-10-9-14-5-1-2-6-15(14)11-16;/h1-11,13H,12H2;1H |
| InChIKey | BUKYMFVJSHUCNP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|