About 2-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione;hydrobromide
2-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione;hydrobromide (PubChem CID 52988773) has the molecular formula C22H15BrN2O2S
and a molecular weight of 451.35 g/mol. Its IUPAC name is 2-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione;hydrobromide.
Molecular Properties
| Compound Name | 2-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione;hydrobromide |
| PubChem CID | 52988773 |
| Molecular Formula | C22H15BrN2O2S |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.00 |
| IUPAC Name | 2-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione;hydrobromide |
| SMILES | Br.O=C1c2ccccc2C(=O)N1Cc1nc(-c2ccc3ccccc3c2)cs1 |
| InChI | InChI=1S/C22H14N2O2S.BrH/c25-21-17-7-3-4-8-18(17)22(26)24(21)12-20-23-19(13-27-20)16-10-9-14-5-1-2-6-15(14)11-16;/h1-11,13H,12H2;1H |
| InChIKey | BUKYMFVJSHUCNP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione;hydrobromide?
The IUPAC name of 2-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione;hydrobromide (CID 52988773) is 2-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione;hydrobromide.
What is the SMILES notation for 2-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione;hydrobromide?
The canonical SMILES for 2-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione;hydrobromide is Br.O=C1c2ccccc2C(=O)N1Cc1nc(-c2ccc3ccccc3c2)cs1.
What is the InChIKey of 2-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione;hydrobromide?
The InChIKey is BUKYMFVJSHUCNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14N2O2S.BrH/c25-21-17-7-3-4-8-18(17)22(26)24(21)12-20-23-19(13-27-20)16-10-9-14-5-1-2-6-15(14)11-16;/h1-11,13H,12H2;1H.
What are the key properties of 2-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione;hydrobromide?
2-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione;hydrobromide has a molecular weight of 451.35 g/mol, XLogP of 5.34, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione;hydrobromide is sourced from PubChem (CID 52988773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).