C19H31FN4O — CID 52991511
N-(3,5-dimethylpyrazolidin-4-yl)-2-[(4-fluorophenyl)methyl-pentylamino]acetamide (PubChem CID 52991511) has the molecular formula C19H31FN4O and a molecular weight of 350.48 g/mol. Its IUPAC name is N-(3,5-dimethylpyrazolidin-4-yl)-2-[(4-fluorophenyl)methyl-pentylamino]acetamide.
| Compound Name | N-(3,5-dimethylpyrazolidin-4-yl)-2-[(4-fluorophenyl)methyl-pentylamino]acetamide |
|---|---|
| PubChem CID | 52991511 |
| Molecular Formula | C19H31FN4O |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | N-(3,5-dimethylpyrazolidin-4-yl)-2-[(4-fluorophenyl)methyl-pentylamino]acetamide |
| SMILES | CCCCCN(CC(=O)NC1C(C)NNC1C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H31FN4O/c1-4-5-6-11-24(12-16-7-9-17(20)10-8-16)13-18(25)21-19-14(2)22-23-15(19)3/h7-10,14-15,19,22-23H,4-6,11-13H2,1-3H3,(H,21,25) |
| InChIKey | JIENHODUMWEFPJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|