C20H29FN4O — CID 86911666
2-[(4-fluorophenyl)methyl-pentylamino]-N-(1,3,5-trimethylpyrazol-4-yl)acetamide (PubChem CID 86911666) has the molecular formula C20H29FN4O and a molecular weight of 360.48 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl-pentylamino]-N-(1,3,5-trimethylpyrazol-4-yl)acetamide.
| Compound Name | 2-[(4-fluorophenyl)methyl-pentylamino]-N-(1,3,5-trimethylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 86911666 |
| Molecular Formula | C20H29FN4O |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl-pentylamino]-N-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| SMILES | CCCCCN(CC(=O)Nc1c(C)nn(C)c1C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H29FN4O/c1-5-6-7-12-25(13-17-8-10-18(21)11-9-17)14-19(26)22-20-15(2)23-24(4)16(20)3/h8-11H,5-7,12-14H2,1-4H3,(H,22,26) |
| InChIKey | CWFLNFNOWUJMKD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|