C27H27F3N6O — CID 12071572
2-[pentyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]-N-(2,4,6-trifluorophenyl)acetamide (PubChem CID 12071572) has the molecular formula C27H27F3N6O and a molecular weight of 508.55 g/mol. Its IUPAC name is 2-[pentyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]-N-(2,4,6-trifluorophenyl)acetamide.
| Compound Name | 2-[pentyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]-N-(2,4,6-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 12071572 |
| Molecular Formula | C27H27F3N6O |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | 2-[pentyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]-N-(2,4,6-trifluorophenyl)acetamide |
| SMILES | CCCCCN(CC(=O)Nc1c(F)cc(F)cc1F)Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C27H27F3N6O/c1-2-3-6-13-36(17-25(37)31-26-23(29)14-20(28)15-24(26)30)16-18-9-11-19(12-10-18)21-7-4-5-8-22(21)27-32-34-35-33-27/h4-5,7-12,14-15H,2-3,6,13,16-17H2,1H3,(H,31,37)(H,32,33,34,35) |
| InChIKey | NEELQNIMDLBHJC-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|