C16H32Cl2N2O — CID 52994083
[1-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]piperidin-2-yl]methanol;dihydrochloride (PubChem CID 52994083) has the molecular formula C16H32Cl2N2O and a molecular weight of 339.35 g/mol. Its IUPAC name is [1-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]piperidin-2-yl]methanol;dihydrochloride.
| Compound Name | [1-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]piperidin-2-yl]methanol;dihydrochloride |
|---|---|
| PubChem CID | 52994083 |
| Molecular Formula | C16H32Cl2N2O |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | [1-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]piperidin-2-yl]methanol;dihydrochloride |
| SMILES | Cl.Cl.OCC1CCCCN1C[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C16H30N2O.2ClH/c19-13-15-7-1-3-10-18(15)12-14-6-5-11-17-9-4-2-8-16(14)17;;/h14-16,19H,1-13H2;2*1H/t14-,15?,16+;;/m0../s1 |
| InChIKey | QQOOYVUHLJFXAI-BQOKTXHKSA-N |
| XLogP | 2.94 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |