C22H26N2O6S — CID 52998147
1-benzylsulfonyl-4-(2,3-dihydro-1H-inden-2-yl)piperazine;oxalic acid (PubChem CID 52998147) has the molecular formula C22H26N2O6S and a molecular weight of 446.53 g/mol. Its IUPAC name is 1-benzylsulfonyl-4-(2,3-dihydro-1H-inden-2-yl)piperazine;oxalic acid.
| Compound Name | 1-benzylsulfonyl-4-(2,3-dihydro-1H-inden-2-yl)piperazine;oxalic acid |
|---|---|
| PubChem CID | 52998147 |
| Molecular Formula | C22H26N2O6S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 1-benzylsulfonyl-4-(2,3-dihydro-1H-inden-2-yl)piperazine;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=S(=O)(Cc1ccccc1)N1CCN(C2Cc3ccccc3C2)CC1 |
| InChI | InChI=1S/C20H24N2O2S.C2H2O4/c23-25(24,16-17-6-2-1-3-7-17)22-12-10-21(11-13-22)20-14-18-8-4-5-9-19(18)15-20;3-1(4)2(5)6/h1-9,20H,10-16H2;(H,3,4)(H,5,6) |
| InChIKey | AYQXIIOFCZEFSH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|