C23H33N5O2 — CID 53001903
N-[3-(4-cyclohexylpiperazin-1-yl)propyl]-5-methyl-3-pyridin-2-yl-1,2-oxazole-4-carboxamide (PubChem CID 53001903) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is N-[3-(4-cyclohexylpiperazin-1-yl)propyl]-5-methyl-3-pyridin-2-yl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[3-(4-cyclohexylpiperazin-1-yl)propyl]-5-methyl-3-pyridin-2-yl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 53001903 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | N-[3-(4-cyclohexylpiperazin-1-yl)propyl]-5-methyl-3-pyridin-2-yl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2ccccn2)c1C(=O)NCCCN1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C23H33N5O2/c1-18-21(22(26-30-18)20-10-5-6-11-24-20)23(29)25-12-7-13-27-14-16-28(17-15-27)19-8-3-2-4-9-19/h5-6,10-11,19H,2-4,7-9,12-17H2,1H3,(H,25,29) |
| InChIKey | YEDJSGCEZSVAHK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|